About CID 10985664
CID 10985664 (PubChem CID 10985664) has the molecular formula C42H44SiSn2
and a molecular weight of 814.32 g/mol.
Molecular Properties
| Compound Name | CID 10985664 |
| PubChem CID | 10985664 |
| Molecular Formula | C42H44SiSn2 |
| Molecular Weight | 814.32 g/mol |
| Exact Mass | 816.13 |
| IUPAC Name | — |
| SMILES | CC(C)[Si]C(C)C.c1ccc([Sn](c2ccccc2)c2ccccc2)cc1.c1ccc([Sn](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C6H14Si.6C6H5.2Sn/c1-5(2)7-6(3)4;6*1-2-4-6-5-3-1;;/h5-6H,1-4H3;6*1-5H;; |
| InChIKey | MNIZRNQCUPUECD-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 814.32 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 10985664 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10985664?
The IUPAC name of CID 10985664 (CID 10985664) is not available.
What is the SMILES notation for CID 10985664?
The canonical SMILES for CID 10985664 is CC(C)[Si]C(C)C.c1ccc([Sn](c2ccccc2)c2ccccc2)cc1.c1ccc([Sn](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of CID 10985664?
The InChIKey is MNIZRNQCUPUECD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14Si.6C6H5.2Sn/c1-5(2)7-6(3)4;6*1-2-4-6-5-3-1;;/h5-6H,1-4H3;6*1-5H;;.
What are the key properties of CID 10985664?
CID 10985664 has a molecular weight of 814.32 g/mol, XLogP of 6.75, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10985664 is sourced from PubChem (CID 10985664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).