About CID 6338116
CID 6338116 (PubChem CID 6338116) has the molecular formula C19H19O3SSn
and a molecular weight of 446.14 g/mol.
Molecular Properties
| Compound Name | CID 6338116 |
| PubChem CID | 6338116 |
| Molecular Formula | C19H19O3SSn |
| Molecular Weight | 446.14 g/mol |
| Exact Mass | 447.01 |
| IUPAC Name | — |
| SMILES | CS(=O)(=O)O.c1ccc([Sn](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/3C6H5.CH4O3S.Sn/c3*1-2-4-6-5-3-1;1-5(2,3)4;/h3*1-5H;1H3,(H,2,3,4); |
| InChIKey | CVRXMSHIIDVADJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.14 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 6338116 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 6338116?
The IUPAC name of CID 6338116 (CID 6338116) is not available.
What is the SMILES notation for CID 6338116?
The canonical SMILES for CID 6338116 is CS(=O)(=O)O.c1ccc([Sn](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of CID 6338116?
The InChIKey is CVRXMSHIIDVADJ-UHFFFAOYSA-N. The full InChI is InChI=1S/3C6H5.CH4O3S.Sn/c3*1-2-4-6-5-3-1;1-5(2,3)4;/h3*1-5H;1H3,(H,2,3,4);.
What are the key properties of CID 6338116?
CID 6338116 has a molecular weight of 446.14 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 6338116 is sourced from PubChem (CID 6338116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).