About CID 174259415
CID 174259415 (PubChem CID 174259415) has the molecular formula C18H19O2Sn
and a molecular weight of 386.06 g/mol.
Molecular Properties
| Compound Name | CID 174259415 |
| PubChem CID | 174259415 |
| Molecular Formula | C18H19O2Sn |
| Molecular Weight | 386.06 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | — |
| SMILES | O.O.c1ccc([Sn](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/3C6H5.2H2O.Sn/c3*1-2-4-6-5-3-1;;;/h3*1-5H;2*1H2; |
| InChIKey | FSHJTJXXDAVLJY-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 63.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.06 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 174259415 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174259415?
The IUPAC name of CID 174259415 (CID 174259415) is not available.
What is the SMILES notation for CID 174259415?
The canonical SMILES for CID 174259415 is O.O.c1ccc([Sn](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of CID 174259415?
The InChIKey is FSHJTJXXDAVLJY-UHFFFAOYSA-N. The full InChI is InChI=1S/3C6H5.2H2O.Sn/c3*1-2-4-6-5-3-1;;;/h3*1-5H;2*1H2;.
What are the key properties of CID 174259415?
CID 174259415 has a molecular weight of 386.06 g/mol, XLogP of 0.55, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174259415 is sourced from PubChem (CID 174259415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).