About tetraiodostannane;bis(tripropylphosphane)
tetraiodostannane;bis(tripropylphosphane) (PubChem CID 10985859) has the molecular formula C18H42I4P2Sn
and a molecular weight of 946.81 g/mol. Its IUPAC name is tetraiodostannane;bis(tripropylphosphane).
Molecular Properties
| Compound Name | tetraiodostannane;bis(tripropylphosphane) |
| PubChem CID | 10985859 |
| Molecular Formula | C18H42I4P2Sn |
| Molecular Weight | 946.81 g/mol |
| Exact Mass | 947.80 |
| IUPAC Name | tetraiodostannane;bis(tripropylphosphane) |
| SMILES | CCCP(CCC)CCC.CCCP(CCC)CCC.I[Sn](I)(I)I |
| InChI | InChI=1S/2C9H21P.4HI.Sn/c2*1-4-7-10(8-5-2)9-6-3;;;;;/h2*4-9H2,1-3H3;4*1H;/q;;;;;;+4/p-4 |
| InChIKey | YOHMTMMVENXDAU-UHFFFAOYSA-J |
| XLogP | 10.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 946.81 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tetraiodostannane;bis(tripropylphosphane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetraiodostannane;bis(tripropylphosphane)?
The IUPAC name of tetraiodostannane;bis(tripropylphosphane) (CID 10985859) is tetraiodostannane;bis(tripropylphosphane).
What is the SMILES notation for tetraiodostannane;bis(tripropylphosphane)?
The canonical SMILES for tetraiodostannane;bis(tripropylphosphane) is CCCP(CCC)CCC.CCCP(CCC)CCC.I[Sn](I)(I)I.
What is the InChIKey of tetraiodostannane;bis(tripropylphosphane)?
The InChIKey is YOHMTMMVENXDAU-UHFFFAOYSA-J. The full InChI is InChI=1S/2C9H21P.4HI.Sn/c2*1-4-7-10(8-5-2)9-6-3;;;;;/h2*4-9H2,1-3H3;4*1H;/q;;;;;;+4/p-4.
What are the key properties of tetraiodostannane;bis(tripropylphosphane)?
tetraiodostannane;bis(tripropylphosphane) has a molecular weight of 946.81 g/mol, XLogP of 10.56, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetraiodostannane;bis(tripropylphosphane) is sourced from PubChem (CID 10985859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).