C12H16O — CID 10986816
(3S,5S)-1-ethenyl-5-methyl-3-prop-2-ynoxycyclohexene (PubChem CID 10986816) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is (3S,5S)-1-ethenyl-5-methyl-3-prop-2-ynoxycyclohexene.
| Compound Name | (3S,5S)-1-ethenyl-5-methyl-3-prop-2-ynoxycyclohexene |
|---|---|
| PubChem CID | 10986816 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | (3S,5S)-1-ethenyl-5-methyl-3-prop-2-ynoxycyclohexene |
| SMILES | C#CCO[C@@H]1C=C(C=C)C[C@H](C)C1 |
| InChI | InChI=1S/C12H16O/c1-4-6-13-12-8-10(3)7-11(5-2)9-12/h1,5,9-10,12H,2,6-8H2,3H3/t10-,12-/m0/s1 |
| InChIKey | GFCQKHAEZJUUHX-JQWIXIFHSA-N |
| XLogP | 2.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|