C14H20O2 — CID 10987794
(6S,9S)-6,9-bis(ethenyl)-3,3-dimethyl-1-oxaspiro[4.4]nonan-2-one (PubChem CID 10987794) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (6S,9S)-6,9-bis(ethenyl)-3,3-dimethyl-1-oxaspiro[4.4]nonan-2-one.
| Compound Name | (6S,9S)-6,9-bis(ethenyl)-3,3-dimethyl-1-oxaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 10987794 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (6S,9S)-6,9-bis(ethenyl)-3,3-dimethyl-1-oxaspiro[4.4]nonan-2-one |
| SMILES | C=C[C@@H]1CC[C@@H](C=C)C12CC(C)(C)C(=O)O2 |
| InChI | InChI=1S/C14H20O2/c1-5-10-7-8-11(6-2)14(10)9-13(3,4)12(15)16-14/h5-6,10-11H,1-2,7-9H2,3-4H3/t10-,11-/m1/s1 |
| InChIKey | ROXRCHDIGGCNMQ-GHMZBOCLSA-N |
| XLogP | 3.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|