C12H9Cl2NO3 — CID 10989772
3-(2,6-dichlorophenyl)-3a,6,7,7a-tetrahydropyrano[3,4-d][1,2]oxazol-4-one (PubChem CID 10989772) has the molecular formula C12H9Cl2NO3 and a molecular weight of 286.11 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-3a,6,7,7a-tetrahydropyrano[3,4-d][1,2]oxazol-4-one.
| Compound Name | 3-(2,6-dichlorophenyl)-3a,6,7,7a-tetrahydropyrano[3,4-d][1,2]oxazol-4-one |
|---|---|
| PubChem CID | 10989772 |
| Molecular Formula | C12H9Cl2NO3 |
| Molecular Weight | 286.11 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-3a,6,7,7a-tetrahydropyrano[3,4-d][1,2]oxazol-4-one |
| SMILES | O=C1OCCC2ON=C(c3c(Cl)cccc3Cl)C12 |
| InChI | InChI=1S/C12H9Cl2NO3/c13-6-2-1-3-7(14)9(6)11-10-8(18-15-11)4-5-17-12(10)16/h1-3,8,10H,4-5H2 |
| InChIKey | HPPZYDYTPMNZLZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.11 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |