C12H9Cl2NO2 — CID 12037574
(3aR,6aR)-3-(2,6-dichlorophenyl)-3a,5,6,6a-tetrahydrocyclopenta[d][1,2]oxazol-4-one (PubChem CID 12037574) has the molecular formula C12H9Cl2NO2 and a molecular weight of 270.11 g/mol. Its IUPAC name is (3aR,6aR)-3-(2,6-dichlorophenyl)-3a,5,6,6a-tetrahydrocyclopenta[d][1,2]oxazol-4-one.
| Compound Name | (3aR,6aR)-3-(2,6-dichlorophenyl)-3a,5,6,6a-tetrahydrocyclopenta[d][1,2]oxazol-4-one |
|---|---|
| PubChem CID | 12037574 |
| Molecular Formula | C12H9Cl2NO2 |
| Molecular Weight | 270.11 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | (3aR,6aR)-3-(2,6-dichlorophenyl)-3a,5,6,6a-tetrahydrocyclopenta[d][1,2]oxazol-4-one |
| SMILES | O=C1CC[C@H]2ON=C(c3c(Cl)cccc3Cl)[C@@H]12 |
| InChI | InChI=1S/C12H9Cl2NO2/c13-6-2-1-3-7(14)10(6)12-11-8(16)4-5-9(11)17-15-12/h1-3,9,11H,4-5H2/t9-,11+/m1/s1 |
| InChIKey | YNDAULSEYACQQW-KOLCDFICSA-N |
| XLogP | 3.08 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.11 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |