C7H4Br2N2O2 — CID 10990467
4,5-dibromo-6-methoxy-2,1,3-benzoxadiazole (PubChem CID 10990467) has the molecular formula C7H4Br2N2O2 and a molecular weight of 307.93 g/mol. Its IUPAC name is 4,5-dibromo-6-methoxy-2,1,3-benzoxadiazole.
| Compound Name | 4,5-dibromo-6-methoxy-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 10990467 |
| Molecular Formula | C7H4Br2N2O2 |
| Molecular Weight | 307.93 g/mol |
| Exact Mass | 305.86 |
| IUPAC Name | 4,5-dibromo-6-methoxy-2,1,3-benzoxadiazole |
| SMILES | COc1cc2nonc2c(Br)c1Br |
| InChI | InChI=1S/C7H4Br2N2O2/c1-12-4-2-3-7(11-13-10-3)6(9)5(4)8/h2H,1H3 |
| InChIKey | OHBVIVMYPQSRBG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.93 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |