C14H25IO2 — CID 10991758
(2R,4S,5S,6S)-5-(iodomethyl)-2,4-di(propan-2-yl)-6-prop-2-enyl-1,3-dioxane (PubChem CID 10991758) has the molecular formula C14H25IO2 and a molecular weight of 352.26 g/mol. Its IUPAC name is (2R,4S,5S,6S)-5-(iodomethyl)-2,4-di(propan-2-yl)-6-prop-2-enyl-1,3-dioxane.
| Compound Name | (2R,4S,5S,6S)-5-(iodomethyl)-2,4-di(propan-2-yl)-6-prop-2-enyl-1,3-dioxane |
|---|---|
| PubChem CID | 10991758 |
| Molecular Formula | C14H25IO2 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (2R,4S,5S,6S)-5-(iodomethyl)-2,4-di(propan-2-yl)-6-prop-2-enyl-1,3-dioxane |
| SMILES | C=CC[C@@H]1O[C@@H](C(C)C)O[C@@H](C(C)C)[C@H]1CI |
| InChI | InChI=1S/C14H25IO2/c1-6-7-12-11(8-15)13(9(2)3)17-14(16-12)10(4)5/h6,9-14H,1,7-8H2,2-5H3/t11-,12-,13-,14+/m0/s1 |
| InChIKey | DSDUYWNDEYCSSP-XDQVBPFNSA-N |
| XLogP | 4.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|