C18H18N3S+ — CID 10992906
3-benzylsulfanyl-1-ethyl-5-phenyl-1,2,4-triazin-1-ium (PubChem CID 10992906) has the molecular formula C18H18N3S+ and a molecular weight of 308.43 g/mol. Its IUPAC name is 3-benzylsulfanyl-1-ethyl-5-phenyl-1,2,4-triazin-1-ium.
| Compound Name | 3-benzylsulfanyl-1-ethyl-5-phenyl-1,2,4-triazin-1-ium |
|---|---|
| PubChem CID | 10992906 |
| Molecular Formula | C18H18N3S+ |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 3-benzylsulfanyl-1-ethyl-5-phenyl-1,2,4-triazin-1-ium |
| SMILES | CC[n+]1cc(-c2ccccc2)nc(SCc2ccccc2)n1 |
| InChI | InChI=1S/C18H18N3S/c1-2-21-13-17(16-11-7-4-8-12-16)19-18(20-21)22-14-15-9-5-3-6-10-15/h3-13H,2,14H2,1H3/q+1 |
| InChIKey | VDLVVPSSHVGRGO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|