C22H27BrO3 — CID 10993476
[(2S,4R,4aS,6S,8R)-8-hydroxy-4,4a-dimethyl-6-prop-1-en-2-yl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl] 4-bromobenzoate (PubChem CID 10993476) has the molecular formula C22H27BrO3 and a molecular weight of 419.36 g/mol. Its IUPAC name is [(2S,4R,4aS,6S,8R)-8-hydroxy-4,4a-dimethyl-6-prop-1-en-2-yl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl] 4-bromobenzoate.
| Compound Name | [(2S,4R,4aS,6S,8R)-8-hydroxy-4,4a-dimethyl-6-prop-1-en-2-yl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl] 4-bromobenzoate |
|---|---|
| PubChem CID | 10993476 |
| Molecular Formula | C22H27BrO3 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | [(2S,4R,4aS,6S,8R)-8-hydroxy-4,4a-dimethyl-6-prop-1-en-2-yl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl] 4-bromobenzoate |
| SMILES | C=C(C)[C@@H]1C[C@@H](O)C2=C[C@@H](OC(=O)c3ccc(Br)cc3)C[C@@H](C)[C@]2(C)C1 |
| InChI | InChI=1S/C22H27BrO3/c1-13(2)16-10-20(24)19-11-18(9-14(3)22(19,4)12-16)26-21(25)15-5-7-17(23)8-6-15/h5-8,11,14,16,18,20,24H,1,9-10,12H2,2-4H3/t14-,16-,18+,20-,22+/m1/s1 |
| InChIKey | PJTAWGCZJCPWFU-YTVDIXBESA-N |
| XLogP | 5.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|