C25H30O2Se — CID 10993901
benzyl (3aS,7S,7aR)-7,7a-dimethyl-2-phenylselanyl-3,3a,4,5,6,7-hexahydro-1H-indene-2-carboxylate (PubChem CID 10993901) has the molecular formula C25H30O2Se and a molecular weight of 441.47 g/mol. Its IUPAC name is benzyl (3aS,7S,7aR)-7,7a-dimethyl-2-phenylselanyl-3,3a,4,5,6,7-hexahydro-1H-indene-2-carboxylate.
| Compound Name | benzyl (3aS,7S,7aR)-7,7a-dimethyl-2-phenylselanyl-3,3a,4,5,6,7-hexahydro-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 10993901 |
| Molecular Formula | C25H30O2Se |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | benzyl (3aS,7S,7aR)-7,7a-dimethyl-2-phenylselanyl-3,3a,4,5,6,7-hexahydro-1H-indene-2-carboxylate |
| SMILES | C[C@H]1CCC[C@H]2CC([Se]c3ccccc3)(C(=O)OCc3ccccc3)C[C@@]21C |
| InChI | InChI=1S/C25H30O2Se/c1-19-10-9-13-21-16-25(18-24(19,21)2,28-22-14-7-4-8-15-22)23(26)27-17-20-11-5-3-6-12-20/h3-8,11-12,14-15,19,21H,9-10,13,16-18H2,1-2H3/t19-,21-,24+,25?/m0/s1 |
| InChIKey | IKPOZOASDTYSGI-QNILSAKFSA-N |
| XLogP | 5.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|