C32H60O3Si — CID 10994930
tri(propan-2-yl)-[(2E,6E,10R)-3,7,11-trimethyl-10-[[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl]dodeca-2,6,11-trienoxy]silane (PubChem CID 10994930) has the molecular formula C32H60O3Si and a molecular weight of 520.92 g/mol. Its IUPAC name is tri(propan-2-yl)-[(2E,6E,10R)-3,7,11-trimethyl-10-[[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl]dodeca-2,6,11-trienoxy]silane.
| Compound Name | tri(propan-2-yl)-[(2E,6E,10R)-3,7,11-trimethyl-10-[[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl]dodeca-2,6,11-trienoxy]silane |
|---|---|
| PubChem CID | 10994930 |
| Molecular Formula | C32H60O3Si |
| Molecular Weight | 520.92 g/mol |
| Exact Mass | 520.43 |
| IUPAC Name | tri(propan-2-yl)-[(2E,6E,10R)-3,7,11-trimethyl-10-[[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl]dodeca-2,6,11-trienoxy]silane |
| SMILES | C=C(C)[C@H](CC/C(C)=C/CC/C(C)=C/CO[Si](C(C)C)(C(C)C)C(C)C)C[C@@H]1OC(C)(C)OC1(C)C |
| InChI | InChI=1S/C32H60O3Si/c1-23(2)29(22-30-31(11,12)35-32(13,14)34-30)19-18-27(9)16-15-17-28(10)20-21-33-36(24(3)4,25(5)6)26(7)8/h16,20,24-26,29-30H,1,15,17-19,21-22H2,2-14H3/b27-16+,28-20+/t29-,30+/m1/s1 |
| InChIKey | OSHXXYBERWZDGB-VSOCNXJASA-N |
| XLogP | 10.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.92 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|