C32H64O5Si2 — CID 10995492
methyl (2Z,4R,5R,7R,8R,9R,10S,12E)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-ethyl-9-methoxy-8,10-dimethyltetradeca-2,12-dienoate (PubChem CID 10995492) has the molecular formula C32H64O5Si2 and a molecular weight of 585.03 g/mol. Its IUPAC name is methyl (2Z,4R,5R,7R,8R,9R,10S,12E)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-ethyl-9-methoxy-8,10-dimethyltetradeca-2,12-dienoate.
| Compound Name | methyl (2Z,4R,5R,7R,8R,9R,10S,12E)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-ethyl-9-methoxy-8,10-dimethyltetradeca-2,12-dienoate |
|---|---|
| PubChem CID | 10995492 |
| Molecular Formula | C32H64O5Si2 |
| Molecular Weight | 585.03 g/mol |
| Exact Mass | 584.43 |
| IUPAC Name | methyl (2Z,4R,5R,7R,8R,9R,10S,12E)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-ethyl-9-methoxy-8,10-dimethyltetradeca-2,12-dienoate |
| SMILES | C/C=C/C[C@H](C)[C@@H](OC)[C@@H](C)[C@@H](C[C@@H](O[Si](C)(C)C(C)(C)C)C(/C=C\C(=O)OC)CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H64O5Si2/c1-17-19-20-24(3)30(35-12)25(4)27(36-38(13,14)31(5,6)7)23-28(37-39(15,16)32(8,9)10)26(18-2)21-22-29(33)34-11/h17,19,21-22,24-28,30H,18,20,23H2,1-16H3/b19-17+,22-21-/t24-,25-,26?,27+,28+,30+/m0/s1 |
| InChIKey | OVVYTXIEMUFYEC-FMEGKLPWSA-N |
| XLogP | 9.17 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.03 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|