C39H47NO3Si — CID 10995631
(3S,4S)-1-benzyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(1S)-1-trityloxyethyl]azetidin-2-one (PubChem CID 10995631) has the molecular formula C39H47NO3Si and a molecular weight of 605.90 g/mol. Its IUPAC name is (3S,4S)-1-benzyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(1S)-1-trityloxyethyl]azetidin-2-one.
| Compound Name | (3S,4S)-1-benzyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(1S)-1-trityloxyethyl]azetidin-2-one |
|---|---|
| PubChem CID | 10995631 |
| Molecular Formula | C39H47NO3Si |
| Molecular Weight | 605.90 g/mol |
| Exact Mass | 605.33 |
| IUPAC Name | (3S,4S)-1-benzyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(1S)-1-trityloxyethyl]azetidin-2-one |
| SMILES | C[C@H](OC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@@H]1[C@@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C39H47NO3Si/c1-29(43-44(6,7)38(3,4)5)35-36(40(37(35)41)28-31-20-12-8-13-21-31)30(2)42-39(32-22-14-9-15-23-32,33-24-16-10-17-25-33)34-26-18-11-19-27-34/h8-27,29-30,35-36H,28H2,1-7H3/t29-,30+,35-,36-/m1/s1 |
| InChIKey | QOJPRPTWZYAMGP-ANCUJIGRSA-N |
| XLogP | 8.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.90 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|