C34H49NO5S2Si — CID 10995841
(E,3R,6S,9R)-9-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-6-(methoxymethoxy)-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]dec-4-en-1-one (PubChem CID 10995841) has the molecular formula C34H49NO5S2Si and a molecular weight of 643.99 g/mol. Its IUPAC name is (E,3R,6S,9R)-9-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-6-(methoxymethoxy)-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]dec-4-en-1-one.
| Compound Name | (E,3R,6S,9R)-9-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-6-(methoxymethoxy)-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]dec-4-en-1-one |
|---|---|
| PubChem CID | 10995841 |
| Molecular Formula | C34H49NO5S2Si |
| Molecular Weight | 643.99 g/mol |
| Exact Mass | 643.28 |
| IUPAC Name | (E,3R,6S,9R)-9-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-6-(methoxymethoxy)-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]dec-4-en-1-one |
| SMILES | COCO[C@H](/C=C/[C@H](O)CC(=O)N1C(=S)SC[C@@H]1C(C)C)CC[C@@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H49NO5S2Si/c1-25(2)31-23-42-33(41)35(31)32(37)22-27(36)19-21-28(39-24-38-7)20-18-26(3)40-43(34(4,5)6,29-14-10-8-11-15-29)30-16-12-9-13-17-30/h8-17,19,21,25-28,31,36H,18,20,22-24H2,1-7H3/b21-19+/t26-,27+,28+,31-/m1/s1 |
| InChIKey | MLQCOIKPLXXTSL-QWUCYMJKSA-N |
| XLogP | 5.91 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.99 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|