C38H49NO4S2Si — CID 54768583
(Z,3R,6S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-6-[tert-butyl(diphenyl)silyl]oxy-3-(methoxymethoxy)dec-4-en-1-one (PubChem CID 54768583) has the molecular formula C38H49NO4S2Si and a molecular weight of 676.03 g/mol. Its IUPAC name is (Z,3R,6S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-6-[tert-butyl(diphenyl)silyl]oxy-3-(methoxymethoxy)dec-4-en-1-one.
| Compound Name | (Z,3R,6S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-6-[tert-butyl(diphenyl)silyl]oxy-3-(methoxymethoxy)dec-4-en-1-one |
|---|---|
| PubChem CID | 54768583 |
| Molecular Formula | C38H49NO4S2Si |
| Molecular Weight | 676.03 g/mol |
| Exact Mass | 675.29 |
| IUPAC Name | (Z,3R,6S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-6-[tert-butyl(diphenyl)silyl]oxy-3-(methoxymethoxy)dec-4-en-1-one |
| SMILES | CCCC[C@@H](/C=C\[C@@H](CC(=O)N1C(=S)SC[C@@H]1Cc1ccccc1)OCOC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C38H49NO4S2Si/c1-6-7-19-32(43-46(38(2,3)4,34-20-13-9-14-21-34)35-22-15-10-16-23-35)24-25-33(42-29-41-5)27-36(40)39-31(28-45-37(39)44)26-30-17-11-8-12-18-30/h8-18,20-25,31-33H,6-7,19,26-29H2,1-5H3/b25-24-/t31-,32-,33-/m0/s1 |
| InChIKey | BTOIJMCOAOCZJM-PRIAMBPPSA-N |
| XLogP | 7.53 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.03 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|