C36H53NO6S2Si — CID 11735100
(E,3R,6S,9R)-9-[tert-butyl(diphenyl)silyl]oxy-3,6-bis(methoxymethoxy)-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]dec-4-en-1-one (PubChem CID 11735100) has the molecular formula C36H53NO6S2Si and a molecular weight of 688.04 g/mol. Its IUPAC name is (E,3R,6S,9R)-9-[tert-butyl(diphenyl)silyl]oxy-3,6-bis(methoxymethoxy)-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]dec-4-en-1-one.
| Compound Name | (E,3R,6S,9R)-9-[tert-butyl(diphenyl)silyl]oxy-3,6-bis(methoxymethoxy)-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]dec-4-en-1-one |
|---|---|
| PubChem CID | 11735100 |
| Molecular Formula | C36H53NO6S2Si |
| Molecular Weight | 688.04 g/mol |
| Exact Mass | 687.31 |
| IUPAC Name | (E,3R,6S,9R)-9-[tert-butyl(diphenyl)silyl]oxy-3,6-bis(methoxymethoxy)-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]dec-4-en-1-one |
| SMILES | COCO[C@H](/C=C/[C@@H](CC(=O)N1C(=S)SC[C@@H]1C(C)C)OCOC)CC[C@@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C36H53NO6S2Si/c1-27(2)33-24-45-35(44)37(33)34(38)23-30(42-26-40-8)22-21-29(41-25-39-7)20-19-28(3)43-46(36(4,5)6,31-15-11-9-12-16-31)32-17-13-10-14-18-32/h9-18,21-22,27-30,33H,19-20,23-26H2,1-8H3/b22-21+/t28-,29+,30+,33-/m1/s1 |
| InChIKey | JKDDAJICIQQHHF-SJSSMOEJSA-N |
| XLogP | 6.54 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.04 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|