C34H47NO3S2Si — CID 102600562
(3R,4E,6E,11S)-11-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]dodeca-4,6-dien-1-one (PubChem CID 102600562) has the molecular formula C34H47NO3S2Si and a molecular weight of 609.97 g/mol. Its IUPAC name is (3R,4E,6E,11S)-11-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]dodeca-4,6-dien-1-one.
| Compound Name | (3R,4E,6E,11S)-11-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]dodeca-4,6-dien-1-one |
|---|---|
| PubChem CID | 102600562 |
| Molecular Formula | C34H47NO3S2Si |
| Molecular Weight | 609.97 g/mol |
| Exact Mass | 609.28 |
| IUPAC Name | (3R,4E,6E,11S)-11-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]dodeca-4,6-dien-1-one |
| SMILES | CC(C)[C@H]1CSC(=S)N1C(=O)C[C@@H](O)/C=C/C=C/CCC[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H47NO3S2Si/c1-26(2)31-25-40-33(39)35(31)32(37)24-28(36)19-13-9-7-8-12-18-27(3)38-41(34(4,5)6,29-20-14-10-15-21-29)30-22-16-11-17-23-30/h7,9-11,13-17,19-23,26-28,31,36H,8,12,18,24-25H2,1-6H3/b9-7+,19-13+/t27-,28-,31+/m0/s1 |
| InChIKey | ATVFORBNLORDKL-LPKWWHASSA-N |
| XLogP | 6.87 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.97 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|