C35H53NO3S2Si2 — CID 134837155
(E,3R,5R)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-phenylhept-6-en-1-one (PubChem CID 134837155) has the molecular formula C35H53NO3S2Si2 and a molecular weight of 656.12 g/mol. Its IUPAC name is (E,3R,5R)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-phenylhept-6-en-1-one.
| Compound Name | (E,3R,5R)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-phenylhept-6-en-1-one |
|---|---|
| PubChem CID | 134837155 |
| Molecular Formula | C35H53NO3S2Si2 |
| Molecular Weight | 656.12 g/mol |
| Exact Mass | 655.30 |
| IUPAC Name | (E,3R,5R)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-phenylhept-6-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CC(=O)N1C(=S)SC[C@H]1Cc1ccccc1)C[C@H](/C=C/c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H53NO3S2Si2/c1-34(2,3)42(7,8)38-30(22-21-27-17-13-11-14-18-27)24-31(39-43(9,10)35(4,5)6)25-32(37)36-29(26-41-33(36)40)23-28-19-15-12-16-20-28/h11-22,29-31H,23-26H2,1-10H3/b22-21+/t29-,30+,31-/m1/s1 |
| InChIKey | XBSMCGOTVJVCRZ-CKGKMZJQSA-N |
| XLogP | 9.73 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.12 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|