C12H22O4Si — CID 10999758
(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(2S)-5-oxooxolan-2-yl]acetaldehyde (PubChem CID 10999758) has the molecular formula C12H22O4Si and a molecular weight of 258.39 g/mol. Its IUPAC name is (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(2S)-5-oxooxolan-2-yl]acetaldehyde.
| Compound Name | (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(2S)-5-oxooxolan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 10999758 |
| Molecular Formula | C12H22O4Si |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(2S)-5-oxooxolan-2-yl]acetaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](C=O)[C@@H]1CCC(=O)O1 |
| InChI | InChI=1S/C12H22O4Si/c1-12(2,3)17(4,5)16-10(8-13)9-6-7-11(14)15-9/h8-10H,6-7H2,1-5H3/t9-,10+/m0/s1 |
| InChIKey | KDWLJAKCZYXOIU-VHSXEESVSA-N |
| XLogP | 2.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|