C11H16N2OS — CID 110004676
[4-(hydroxymethyl)phenyl]methyl N,N'-dimethylcarbamimidothioate (PubChem CID 110004676) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is [4-(hydroxymethyl)phenyl]methyl N,N'-dimethylcarbamimidothioate.
| Compound Name | [4-(hydroxymethyl)phenyl]methyl N,N'-dimethylcarbamimidothioate |
|---|---|
| PubChem CID | 110004676 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | [4-(hydroxymethyl)phenyl]methyl N,N'-dimethylcarbamimidothioate |
| SMILES | C/N=C(\NC)SCc1ccc(CO)cc1 |
| InChI | InChI=1S/C11H16N2OS/c1-12-11(13-2)15-8-10-5-3-9(7-14)4-6-10/h3-6,14H,7-8H2,1-2H3,(H,12,13) |
| InChIKey | VGVFXGVHHAHRLK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|