C16H22O3S — CID 11000894
(2E,6E)-8-(benzenesulfonyl)-2,6-dimethylocta-2,6-dien-1-ol (PubChem CID 11000894) has the molecular formula C16H22O3S and a molecular weight of 294.42 g/mol. Its IUPAC name is (2E,6E)-8-(benzenesulfonyl)-2,6-dimethylocta-2,6-dien-1-ol.
| Compound Name | (2E,6E)-8-(benzenesulfonyl)-2,6-dimethylocta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 11000894 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (2E,6E)-8-(benzenesulfonyl)-2,6-dimethylocta-2,6-dien-1-ol |
| SMILES | C/C(=C\CC/C(C)=C/CS(=O)(=O)c1ccccc1)CO |
| InChI | InChI=1S/C16H22O3S/c1-14(7-6-8-15(2)13-17)11-12-20(18,19)16-9-4-3-5-10-16/h3-5,8-11,17H,6-7,12-13H2,1-2H3/b14-11+,15-8+ |
| InChIKey | WBZHBFXJQWQAPK-GGQZXFEVSA-N |
| XLogP | 3.13 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|