C19H20N2OS — CID 110010749
1-[[phenyl(pyridin-2-yl)methyl]amino]-2-thiophen-2-ylpropan-2-ol (PubChem CID 110010749) has the molecular formula C19H20N2OS and a molecular weight of 324.45 g/mol. Its IUPAC name is 1-[[phenyl(pyridin-2-yl)methyl]amino]-2-thiophen-2-ylpropan-2-ol.
| Compound Name | 1-[[phenyl(pyridin-2-yl)methyl]amino]-2-thiophen-2-ylpropan-2-ol |
|---|---|
| PubChem CID | 110010749 |
| Molecular Formula | C19H20N2OS |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 1-[[phenyl(pyridin-2-yl)methyl]amino]-2-thiophen-2-ylpropan-2-ol |
| SMILES | CC(O)(CNC(c1ccccc1)c1ccccn1)c1cccs1 |
| InChI | InChI=1S/C19H20N2OS/c1-19(22,17-11-7-13-23-17)14-21-18(15-8-3-2-4-9-15)16-10-5-6-12-20-16/h2-13,18,21-22H,14H2,1H3 |
| InChIKey | RASMIBWSOJHPAL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |