C21H24N2O2 — CID 110016422
N-cyclopropyl-2-hydroxy-N-[(3-pyridin-3-ylphenyl)methyl]cyclopentane-1-carboxamide (PubChem CID 110016422) has the molecular formula C21H24N2O2 and a molecular weight of 336.43 g/mol. Its IUPAC name is N-cyclopropyl-2-hydroxy-N-[(3-pyridin-3-ylphenyl)methyl]cyclopentane-1-carboxamide.
| Compound Name | N-cyclopropyl-2-hydroxy-N-[(3-pyridin-3-ylphenyl)methyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 110016422 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N-cyclopropyl-2-hydroxy-N-[(3-pyridin-3-ylphenyl)methyl]cyclopentane-1-carboxamide |
| SMILES | O=C(C1CCCC1O)N(Cc1cccc(-c2cccnc2)c1)C1CC1 |
| InChI | InChI=1S/C21H24N2O2/c24-20-8-2-7-19(20)21(25)23(18-9-10-18)14-15-4-1-5-16(12-15)17-6-3-11-22-13-17/h1,3-6,11-13,18-20,24H,2,7-10,14H2 |
| InChIKey | YKJXHLGKMFPZEA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |