About [6-methyl-1-(1,3-thiazol-2-ylmethyl)piperidin-2-yl]methanol
[6-methyl-1-(1,3-thiazol-2-ylmethyl)piperidin-2-yl]methanol (PubChem CID 110016925) has the molecular formula C11H18N2OS
and a molecular weight of 226.34 g/mol. Its IUPAC name is [6-methyl-1-(1,3-thiazol-2-ylmethyl)piperidin-2-yl]methanol.
Molecular Properties
| Compound Name | [6-methyl-1-(1,3-thiazol-2-ylmethyl)piperidin-2-yl]methanol |
| PubChem CID | 110016925 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | [6-methyl-1-(1,3-thiazol-2-ylmethyl)piperidin-2-yl]methanol |
| SMILES | CC1CCCC(CO)N1Cc1nccs1 |
| InChI | InChI=1S/C11H18N2OS/c1-9-3-2-4-10(8-14)13(9)7-11-12-5-6-15-11/h5-6,9-10,14H,2-4,7-8H2,1H3 |
| InChIKey | KNKACVSTKVPMLP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [6-methyl-1-(1,3-thiazol-2-ylmethyl)piperidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-methyl-1-(1,3-thiazol-2-ylmethyl)piperidin-2-yl]methanol?
The IUPAC name of [6-methyl-1-(1,3-thiazol-2-ylmethyl)piperidin-2-yl]methanol (CID 110016925) is [6-methyl-1-(1,3-thiazol-2-ylmethyl)piperidin-2-yl]methanol.
What is the SMILES notation for [6-methyl-1-(1,3-thiazol-2-ylmethyl)piperidin-2-yl]methanol?
The canonical SMILES for [6-methyl-1-(1,3-thiazol-2-ylmethyl)piperidin-2-yl]methanol is CC1CCCC(CO)N1Cc1nccs1.
What is the InChIKey of [6-methyl-1-(1,3-thiazol-2-ylmethyl)piperidin-2-yl]methanol?
The InChIKey is KNKACVSTKVPMLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2OS/c1-9-3-2-4-10(8-14)13(9)7-11-12-5-6-15-11/h5-6,9-10,14H,2-4,7-8H2,1H3.
What are the key properties of [6-methyl-1-(1,3-thiazol-2-ylmethyl)piperidin-2-yl]methanol?
[6-methyl-1-(1,3-thiazol-2-ylmethyl)piperidin-2-yl]methanol has a molecular weight of 226.34 g/mol, XLogP of 1.88, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-methyl-1-(1,3-thiazol-2-ylmethyl)piperidin-2-yl]methanol is sourced from PubChem (CID 110016925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).