C13H15N5O2S — CID 110017138
2-[4-[(4-cyanothiophen-2-yl)methylamino]pyrazol-1-yl]-N-(2-hydroxyethyl)acetamide (PubChem CID 110017138) has the molecular formula C13H15N5O2S and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-[4-[(4-cyanothiophen-2-yl)methylamino]pyrazol-1-yl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | 2-[4-[(4-cyanothiophen-2-yl)methylamino]pyrazol-1-yl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 110017138 |
| Molecular Formula | C13H15N5O2S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-[4-[(4-cyanothiophen-2-yl)methylamino]pyrazol-1-yl]-N-(2-hydroxyethyl)acetamide |
| SMILES | N#Cc1csc(CNc2cnn(CC(=O)NCCO)c2)c1 |
| InChI | InChI=1S/C13H15N5O2S/c14-4-10-3-12(21-9-10)6-16-11-5-17-18(7-11)8-13(20)15-1-2-19/h3,5,7,9,16,19H,1-2,6,8H2,(H,15,20) |
| InChIKey | BBVLLUGSUTYXPJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 102.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |