C14H18FNO3 — CID 110019175
2-[3-[(5-fluoro-1-benzofuran-2-yl)methylamino]propoxy]ethanol (PubChem CID 110019175) has the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. Its IUPAC name is 2-[3-[(5-fluoro-1-benzofuran-2-yl)methylamino]propoxy]ethanol.
| Compound Name | 2-[3-[(5-fluoro-1-benzofuran-2-yl)methylamino]propoxy]ethanol |
|---|---|
| PubChem CID | 110019175 |
| Molecular Formula | C14H18FNO3 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-[3-[(5-fluoro-1-benzofuran-2-yl)methylamino]propoxy]ethanol |
| SMILES | OCCOCCCNCc1cc2cc(F)ccc2o1 |
| InChI | InChI=1S/C14H18FNO3/c15-12-2-3-14-11(8-12)9-13(19-14)10-16-4-1-6-18-7-5-17/h2-3,8-9,16-17H,1,4-7,10H2 |
| InChIKey | LEDWHODYHKNYAW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|