C19H38O3Si — CID 11002399
[(Z,2S,3S)-3-methyl-1-tri(propan-2-yl)silyloxyhex-4-en-2-yl] propanoate (PubChem CID 11002399) has the molecular formula C19H38O3Si and a molecular weight of 342.60 g/mol. Its IUPAC name is [(Z,2S,3S)-3-methyl-1-tri(propan-2-yl)silyloxyhex-4-en-2-yl] propanoate.
| Compound Name | [(Z,2S,3S)-3-methyl-1-tri(propan-2-yl)silyloxyhex-4-en-2-yl] propanoate |
|---|---|
| PubChem CID | 11002399 |
| Molecular Formula | C19H38O3Si |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | [(Z,2S,3S)-3-methyl-1-tri(propan-2-yl)silyloxyhex-4-en-2-yl] propanoate |
| SMILES | C/C=C\[C@H](C)[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)OC(=O)CC |
| InChI | InChI=1S/C19H38O3Si/c1-10-12-17(9)18(22-19(20)11-2)13-21-23(14(3)4,15(5)6)16(7)8/h10,12,14-18H,11,13H2,1-9H3/b12-10-/t17-,18+/m0/s1 |
| InChIKey | UHNVMATUFGTGJV-TYUFWACSSA-N |
| XLogP | 5.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|