C18H28IN5O2 — CID 110029121
1-[(1-ethylpyrrolidin-2-yl)methyl]-2-[[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 110029121) has the molecular formula C18H28IN5O2 and a molecular weight of 473.36 g/mol. Its IUPAC name is 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-[[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-[[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110029121 |
| Molecular Formula | C18H28IN5O2 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-[[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN1CCCC1CN/C(N)=N/Cc1ccc(N2CCOC2=O)cc1.I |
| InChI | InChI=1S/C18H27N5O2.HI/c1-2-22-9-3-4-16(22)13-21-17(19)20-12-14-5-7-15(8-6-14)23-10-11-25-18(23)24;/h5-8,16H,2-4,9-13H2,1H3,(H3,19,20,21);1H |
| InChIKey | KTROVXNQZHRLCF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|