C16H26IN5 — CID 110031877
1-cyclopropyl-1-methyl-2-[(1-pyridin-4-ylpiperidin-4-yl)methyl]guanidine;hydroiodide (PubChem CID 110031877) has the molecular formula C16H26IN5 and a molecular weight of 415.32 g/mol. Its IUPAC name is 1-cyclopropyl-1-methyl-2-[(1-pyridin-4-ylpiperidin-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-1-methyl-2-[(1-pyridin-4-ylpiperidin-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110031877 |
| Molecular Formula | C16H26IN5 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 1-cyclopropyl-1-methyl-2-[(1-pyridin-4-ylpiperidin-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CN(/C(N)=N/CC1CCN(c2ccncc2)CC1)C1CC1.I |
| InChI | InChI=1S/C16H25N5.HI/c1-20(14-2-3-14)16(17)19-12-13-6-10-21(11-7-13)15-4-8-18-9-5-15;/h4-5,8-9,13-14H,2-3,6-7,10-12H2,1H3,(H2,17,19);1H |
| InChIKey | YJJKFZKUOLMZNO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 57.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|