C18H33N7O2 — CID 110033705
2-[[N'-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-N-(2-morpholin-4-ylethyl)carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 110033705) has the molecular formula C18H33N7O2 and a molecular weight of 379.51 g/mol. Its IUPAC name is 2-[[N'-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-N-(2-morpholin-4-ylethyl)carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N'-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-N-(2-morpholin-4-ylethyl)carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110033705 |
| Molecular Formula | C18H33N7O2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | 2-[[N'-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-N-(2-morpholin-4-ylethyl)carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | CCc1nn(C)cc1C/N=C(/NCCN1CCOCC1)NCC(=O)N(C)C |
| InChI | InChI=1S/C18H33N7O2/c1-5-16-15(14-24(4)22-16)12-20-18(21-13-17(26)23(2)3)19-6-7-25-8-10-27-11-9-25/h14H,5-13H2,1-4H3,(H2,19,20,21) |
| InChIKey | YYKKHQKKZVOXLQ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 87.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|