C15H25BrN4OS — CID 110038113
2-[[[(5-bromothiophen-2-yl)methyl-methylamino]-(butan-2-ylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110038113) has the molecular formula C15H25BrN4OS and a molecular weight of 389.36 g/mol. Its IUPAC name is 2-[[[(5-bromothiophen-2-yl)methyl-methylamino]-(butan-2-ylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[(5-bromothiophen-2-yl)methyl-methylamino]-(butan-2-ylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110038113 |
| Molecular Formula | C15H25BrN4OS |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 2-[[[(5-bromothiophen-2-yl)methyl-methylamino]-(butan-2-ylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCC(C)N/C(=N\CC(=O)N(C)C)N(C)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C15H25BrN4OS/c1-6-11(2)18-15(17-9-14(21)19(3)4)20(5)10-12-7-8-13(16)22-12/h7-8,11H,6,9-10H2,1-5H3,(H,17,18) |
| InChIKey | JAJMPAYLIFNSCV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|