C23H30N4O — CID 110039795
N,N-dimethyl-2-[[(1-phenylethylamino)-(3-phenylpyrrolidin-1-yl)methylidene]amino]acetamide (PubChem CID 110039795) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(1-phenylethylamino)-(3-phenylpyrrolidin-1-yl)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(1-phenylethylamino)-(3-phenylpyrrolidin-1-yl)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110039795 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | N,N-dimethyl-2-[[(1-phenylethylamino)-(3-phenylpyrrolidin-1-yl)methylidene]amino]acetamide |
| SMILES | CC(N/C(=N\CC(=O)N(C)C)N1CCC(c2ccccc2)C1)c1ccccc1 |
| InChI | InChI=1S/C23H30N4O/c1-18(19-10-6-4-7-11-19)25-23(24-16-22(28)26(2)3)27-15-14-21(17-27)20-12-8-5-9-13-20/h4-13,18,21H,14-17H2,1-3H3,(H,24,25) |
| InChIKey | LGKFYXXVBLWEAK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|