C15H28N4O — CID 110043135
N,N-dimethyl-2-[[(prop-2-enylamino)-(2,2,3,3-tetramethylazetidin-1-yl)methylidene]amino]acetamide (PubChem CID 110043135) has the molecular formula C15H28N4O and a molecular weight of 280.42 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(prop-2-enylamino)-(2,2,3,3-tetramethylazetidin-1-yl)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(prop-2-enylamino)-(2,2,3,3-tetramethylazetidin-1-yl)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110043135 |
| Molecular Formula | C15H28N4O |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | N,N-dimethyl-2-[[(prop-2-enylamino)-(2,2,3,3-tetramethylazetidin-1-yl)methylidene]amino]acetamide |
| SMILES | C=CCN/C(=N\CC(=O)N(C)C)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C15H28N4O/c1-8-9-16-13(17-10-12(20)18(6)7)19-11-14(2,3)15(19,4)5/h8H,1,9-11H2,2-7H3,(H,16,17) |
| InChIKey | UAVYLJCIXYDOIY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|