C22H36N4O3S — CID 110043999
2-[[[4-(3-methoxypropoxy)piperidin-1-yl]-(2-phenylsulfanylethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110043999) has the molecular formula C22H36N4O3S and a molecular weight of 436.62 g/mol. Its IUPAC name is 2-[[[4-(3-methoxypropoxy)piperidin-1-yl]-(2-phenylsulfanylethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[4-(3-methoxypropoxy)piperidin-1-yl]-(2-phenylsulfanylethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110043999 |
| Molecular Formula | C22H36N4O3S |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 2-[[[4-(3-methoxypropoxy)piperidin-1-yl]-(2-phenylsulfanylethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | COCCCOC1CCN(/C(=N/CC(=O)N(C)C)NCCSc2ccccc2)CC1 |
| InChI | InChI=1S/C22H36N4O3S/c1-25(2)21(27)18-24-22(23-12-17-30-20-8-5-4-6-9-20)26-13-10-19(11-14-26)29-16-7-15-28-3/h4-6,8-9,19H,7,10-18H2,1-3H3,(H,23,24) |
| InChIKey | IJSAGMCRQBHTSP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|