C17H33N5O2 — CID 110044119
2-[1-[N-butan-2-yl-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]piperidin-4-yl]-N-methylacetamide (PubChem CID 110044119) has the molecular formula C17H33N5O2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 2-[1-[N-butan-2-yl-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]piperidin-4-yl]-N-methylacetamide.
| Compound Name | 2-[1-[N-butan-2-yl-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]piperidin-4-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 110044119 |
| Molecular Formula | C17H33N5O2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | 2-[1-[N-butan-2-yl-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]piperidin-4-yl]-N-methylacetamide |
| SMILES | CCC(C)N/C(=N\CC(=O)N(C)C)N1CCC(CC(=O)NC)CC1 |
| InChI | InChI=1S/C17H33N5O2/c1-6-13(2)20-17(19-12-16(24)21(4)5)22-9-7-14(8-10-22)11-15(23)18-3/h13-14H,6-12H2,1-5H3,(H,18,23)(H,19,20) |
| InChIKey | YNDYMVJNBUYFAW-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|