C21H43N5O4 — CID 110046771
tert-butyl N-[2-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(3-ethoxypropyl)carbamimidoyl]amino]hexyl]carbamate (PubChem CID 110046771) has the molecular formula C21H43N5O4 and a molecular weight of 429.61 g/mol. Its IUPAC name is tert-butyl N-[2-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(3-ethoxypropyl)carbamimidoyl]amino]hexyl]carbamate.
| Compound Name | tert-butyl N-[2-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(3-ethoxypropyl)carbamimidoyl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 110046771 |
| Molecular Formula | C21H43N5O4 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.33 |
| IUPAC Name | tert-butyl N-[2-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(3-ethoxypropyl)carbamimidoyl]amino]hexyl]carbamate |
| SMILES | CCCCC(CNC(=O)OC(C)(C)C)N/C(=N/CC(=O)N(C)C)NCCCOCC |
| InChI | InChI=1S/C21H43N5O4/c1-8-10-12-17(15-24-20(28)30-21(3,4)5)25-19(22-13-11-14-29-9-2)23-16-18(27)26(6)7/h17H,8-16H2,1-7H3,(H,24,28)(H2,22,23,25) |
| InChIKey | MIPAPQJPZLHKTG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|