C18H36IN5O3 — CID 110035858
tert-butyl N-[1-cyclopropyl-2-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-propylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 110035858) has the molecular formula C18H36IN5O3 and a molecular weight of 497.42 g/mol. Its IUPAC name is tert-butyl N-[1-cyclopropyl-2-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-propylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[1-cyclopropyl-2-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-propylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 110035858 |
| Molecular Formula | C18H36IN5O3 |
| Molecular Weight | 497.42 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | tert-butyl N-[1-cyclopropyl-2-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-propylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | CCCN/C(=N\CC(=O)N(C)C)NCC(NC(=O)OC(C)(C)C)C1CC1.I |
| InChI | InChI=1S/C18H35N5O3.HI/c1-7-10-19-16(21-12-15(24)23(5)6)20-11-14(13-8-9-13)22-17(25)26-18(2,3)4;/h13-14H,7-12H2,1-6H3,(H,22,25)(H2,19,20,21);1H |
| InChIKey | GVMZDSUCVZPRTN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|