C14H27N3O3 — CID 124617896
tert-butyl N-[(2R)-2-cyclopropyl-2-[[2-(dimethylamino)-2-oxoethyl]amino]ethyl]carbamate (PubChem CID 124617896) has the molecular formula C14H27N3O3 and a molecular weight of 285.39 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-cyclopropyl-2-[[2-(dimethylamino)-2-oxoethyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-cyclopropyl-2-[[2-(dimethylamino)-2-oxoethyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 124617896 |
| Molecular Formula | C14H27N3O3 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | tert-butyl N-[(2R)-2-cyclopropyl-2-[[2-(dimethylamino)-2-oxoethyl]amino]ethyl]carbamate |
| SMILES | CN(C)C(=O)CN[C@@H](CNC(=O)OC(C)(C)C)C1CC1 |
| InChI | InChI=1S/C14H27N3O3/c1-14(2,3)20-13(19)16-8-11(10-6-7-10)15-9-12(18)17(4)5/h10-11,15H,6-9H2,1-5H3,(H,16,19)/t11-/m0/s1 |
| InChIKey | QWXZTFNBSJOHOF-NSHDSACASA-N |
| XLogP | 0.97 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |