C33H44O6 — CID 11006022
(1R,3S,4S,6R,8R,10S,12R,13S)-1-methyl-4-phenylmethoxy-6-(3-phenylmethoxypropyl)-12-prop-2-enyl-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-13-ol (PubChem CID 11006022) has the molecular formula C33H44O6 and a molecular weight of 536.71 g/mol. Its IUPAC name is (1R,3S,4S,6R,8R,10S,12R,13S)-1-methyl-4-phenylmethoxy-6-(3-phenylmethoxypropyl)-12-prop-2-enyl-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-13-ol.
| Compound Name | (1R,3S,4S,6R,8R,10S,12R,13S)-1-methyl-4-phenylmethoxy-6-(3-phenylmethoxypropyl)-12-prop-2-enyl-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-13-ol |
|---|---|
| PubChem CID | 11006022 |
| Molecular Formula | C33H44O6 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | (1R,3S,4S,6R,8R,10S,12R,13S)-1-methyl-4-phenylmethoxy-6-(3-phenylmethoxypropyl)-12-prop-2-enyl-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-13-ol |
| SMILES | C=CC[C@H]1O[C@H]2C[C@H]3O[C@H](CCCOCc4ccccc4)C[C@H](OCc4ccccc4)[C@@H]3O[C@]2(C)CC[C@@H]1O |
| InChI | InChI=1S/C33H44O6/c1-3-11-28-27(34)17-18-33(2)31(38-28)21-30-32(39-33)29(36-23-25-14-8-5-9-15-25)20-26(37-30)16-10-19-35-22-24-12-6-4-7-13-24/h3-9,12-15,26-32,34H,1,10-11,16-23H2,2H3/t26-,27+,28-,29+,30-,31+,32+,33-/m1/s1 |
| InChIKey | IFTFRHTUEKBIAS-MGEJVZHUSA-N |
| XLogP | 5.76 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|