C34H44O6 — CID 10984458
(1S,3R,9S,12R,14S,15S,17R,19R)-12-methyl-15-phenylmethoxy-17-(3-phenylmethoxypropyl)-2,8,13,18-tetraoxatetracyclo[10.8.0.03,9.014,19]icos-6-ene (PubChem CID 10984458) has the molecular formula C34H44O6 and a molecular weight of 548.72 g/mol. Its IUPAC name is (1S,3R,9S,12R,14S,15S,17R,19R)-12-methyl-15-phenylmethoxy-17-(3-phenylmethoxypropyl)-2,8,13,18-tetraoxatetracyclo[10.8.0.03,9.014,19]icos-6-ene.
| Compound Name | (1S,3R,9S,12R,14S,15S,17R,19R)-12-methyl-15-phenylmethoxy-17-(3-phenylmethoxypropyl)-2,8,13,18-tetraoxatetracyclo[10.8.0.03,9.014,19]icos-6-ene |
|---|---|
| PubChem CID | 10984458 |
| Molecular Formula | C34H44O6 |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | (1S,3R,9S,12R,14S,15S,17R,19R)-12-methyl-15-phenylmethoxy-17-(3-phenylmethoxypropyl)-2,8,13,18-tetraoxatetracyclo[10.8.0.03,9.014,19]icos-6-ene |
| SMILES | C[C@@]12CC[C@@H]3OC=CCC[C@H]3O[C@H]1C[C@H]1O[C@H](CCCOCc3ccccc3)C[C@H](OCc3ccccc3)[C@@H]1O2 |
| InChI | InChI=1S/C34H44O6/c1-34-18-17-28-29(16-8-9-20-36-28)39-32(34)22-31-33(40-34)30(37-24-26-13-6-3-7-14-26)21-27(38-31)15-10-19-35-23-25-11-4-2-5-12-25/h2-7,9,11-14,20,27-33H,8,10,15-19,21-24H2,1H3/t27-,28+,29-,30+,31-,32+,33+,34-/m1/s1 |
| InChIKey | HMUDYCIJFQWZLR-DGEKNRBVSA-N |
| XLogP | 6.51 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|