C34H49NO5Si — CID 11365241
2-[(2R,3S,4aR,6R,8S,8aS)-3-[tert-butyl(dimethyl)silyl]oxy-8a-methyl-8-phenylmethoxy-6-(3-phenylmethoxypropyl)-3,4,4a,6,7,8-hexahydro-2H-pyrano[3,2-b]pyran-2-yl]acetonitrile (PubChem CID 11365241) has the molecular formula C34H49NO5Si and a molecular weight of 579.85 g/mol. Its IUPAC name is 2-[(2R,3S,4aR,6R,8S,8aS)-3-[tert-butyl(dimethyl)silyl]oxy-8a-methyl-8-phenylmethoxy-6-(3-phenylmethoxypropyl)-3,4,4a,6,7,8-hexahydro-2H-pyrano[3,2-b]pyran-2-yl]acetonitrile.
| Compound Name | 2-[(2R,3S,4aR,6R,8S,8aS)-3-[tert-butyl(dimethyl)silyl]oxy-8a-methyl-8-phenylmethoxy-6-(3-phenylmethoxypropyl)-3,4,4a,6,7,8-hexahydro-2H-pyrano[3,2-b]pyran-2-yl]acetonitrile |
|---|---|
| PubChem CID | 11365241 |
| Molecular Formula | C34H49NO5Si |
| Molecular Weight | 579.85 g/mol |
| Exact Mass | 579.34 |
| IUPAC Name | 2-[(2R,3S,4aR,6R,8S,8aS)-3-[tert-butyl(dimethyl)silyl]oxy-8a-methyl-8-phenylmethoxy-6-(3-phenylmethoxypropyl)-3,4,4a,6,7,8-hexahydro-2H-pyrano[3,2-b]pyran-2-yl]acetonitrile |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H]2O[C@H](CCCOCc3ccccc3)C[C@H](OCc3ccccc3)[C@]2(C)O[C@@H]1CC#N |
| InChI | InChI=1S/C34H49NO5Si/c1-33(2,3)41(5,6)40-30-23-32-34(4,39-29(30)19-20-35)31(37-25-27-16-11-8-12-17-27)22-28(38-32)18-13-21-36-24-26-14-9-7-10-15-26/h7-12,14-17,28-32H,13,18-19,21-25H2,1-6H3/t28-,29-,30+,31+,32-,34+/m1/s1 |
| InChIKey | YKPAALFDLIYOMA-VGTYUCJZSA-N |
| XLogP | 7.58 |
| TPSA | 69.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.85 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|