C25H33ClN4O5 — CID 110062495
(4R,7S,15S)-20-chloro-N-cyclobutyl-4,5-dimethyl-6,12,17-trioxo-2-oxa-5,11,16-triazatricyclo[16.4.0.07,11]docosa-1(18),19,21-triene-15-carboxamide (PubChem CID 110062495) has the molecular formula C25H33ClN4O5 and a molecular weight of 505.02 g/mol. Its IUPAC name is (4R,7S,15S)-20-chloro-N-cyclobutyl-4,5-dimethyl-6,12,17-trioxo-2-oxa-5,11,16-triazatricyclo[16.4.0.07,11]docosa-1(18),19,21-triene-15-carboxamide.
| Compound Name | (4R,7S,15S)-20-chloro-N-cyclobutyl-4,5-dimethyl-6,12,17-trioxo-2-oxa-5,11,16-triazatricyclo[16.4.0.07,11]docosa-1(18),19,21-triene-15-carboxamide |
|---|---|
| PubChem CID | 110062495 |
| Molecular Formula | C25H33ClN4O5 |
| Molecular Weight | 505.02 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | (4R,7S,15S)-20-chloro-N-cyclobutyl-4,5-dimethyl-6,12,17-trioxo-2-oxa-5,11,16-triazatricyclo[16.4.0.07,11]docosa-1(18),19,21-triene-15-carboxamide |
| SMILES | C[C@@H]1COc2ccc(Cl)cc2C(=O)N[C@H](C(=O)NC2CCC2)CCC(=O)N2CCC[C@H]2C(=O)N1C |
| InChI | InChI=1S/C25H33ClN4O5/c1-15-14-35-21-10-8-16(26)13-18(21)23(32)28-19(24(33)27-17-5-3-6-17)9-11-22(31)30-12-4-7-20(30)25(34)29(15)2/h8,10,13,15,17,19-20H,3-7,9,11-12,14H2,1-2H3,(H,27,33)(H,28,32)/t15-,19+,20+/m1/s1 |
| InChIKey | NBLOAPPSJVTINH-XPGWFJOJSA-N |
| XLogP | 2.12 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.02 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |