C28H39N3O2 — CID 110071916
[4-(2-methylpropoxy)phenyl]-[(1S,14R)-17-propan-2-yl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]methanone (PubChem CID 110071916) has the molecular formula C28H39N3O2 and a molecular weight of 449.64 g/mol. Its IUPAC name is [4-(2-methylpropoxy)phenyl]-[(1S,14R)-17-propan-2-yl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]methanone.
| Compound Name | [4-(2-methylpropoxy)phenyl]-[(1S,14R)-17-propan-2-yl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]methanone |
|---|---|
| PubChem CID | 110071916 |
| Molecular Formula | C28H39N3O2 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | [4-(2-methylpropoxy)phenyl]-[(1S,14R)-17-propan-2-yl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]methanone |
| SMILES | CC(C)COc1ccc(C(=O)N2Cc3ccccc3NCC[C@H]3CC[C@@H](C2)N3C(C)C)cc1 |
| InChI | InChI=1S/C28H39N3O2/c1-20(2)19-33-26-13-9-22(10-14-26)28(32)30-17-23-7-5-6-8-27(23)29-16-15-24-11-12-25(18-30)31(24)21(3)4/h5-10,13-14,20-21,24-25,29H,11-12,15-19H2,1-4H3/t24-,25+/m1/s1 |
| InChIKey | UVPMBWNFHUEIQL-RPBOFIJWSA-N |
| XLogP | 5.42 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |