C27H33N3O2 — CID 110082031
N-benzyl-N-methyl-2-[4-(phenoxymethyl)-1-(1H-pyrrol-2-ylmethyl)piperidin-4-yl]acetamide (PubChem CID 110082031) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-[4-(phenoxymethyl)-1-(1H-pyrrol-2-ylmethyl)piperidin-4-yl]acetamide.
| Compound Name | N-benzyl-N-methyl-2-[4-(phenoxymethyl)-1-(1H-pyrrol-2-ylmethyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 110082031 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | N-benzyl-N-methyl-2-[4-(phenoxymethyl)-1-(1H-pyrrol-2-ylmethyl)piperidin-4-yl]acetamide |
| SMILES | CN(Cc1ccccc1)C(=O)CC1(COc2ccccc2)CCN(Cc2ccc[nH]2)CC1 |
| InChI | InChI=1S/C27H33N3O2/c1-29(20-23-9-4-2-5-10-23)26(31)19-27(22-32-25-12-6-3-7-13-25)14-17-30(18-15-27)21-24-11-8-16-28-24/h2-13,16,28H,14-15,17-22H2,1H3 |
| InChIKey | FHEVIKWFYWAXMX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |