C10H8Cl3N — CID 11010330
4,4-dichloro-5-(4-chlorophenyl)-2,3-dihydropyrrole (PubChem CID 11010330) has the molecular formula C10H8Cl3N and a molecular weight of 248.54 g/mol. Its IUPAC name is 4,4-dichloro-5-(4-chlorophenyl)-2,3-dihydropyrrole.
| Compound Name | 4,4-dichloro-5-(4-chlorophenyl)-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 11010330 |
| Molecular Formula | C10H8Cl3N |
| Molecular Weight | 248.54 g/mol |
| Exact Mass | 246.97 |
| IUPAC Name | 4,4-dichloro-5-(4-chlorophenyl)-2,3-dihydropyrrole |
| SMILES | Clc1ccc(C2=NCCC2(Cl)Cl)cc1 |
| InChI | InChI=1S/C10H8Cl3N/c11-8-3-1-7(2-4-8)9-10(12,13)5-6-14-9/h1-4H,5-6H2 |
| InChIKey | CERKWCASYPHPSW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|