C15H30FNO2 — CID 11011232
(2S,3S)-N,N-diethyl-2-fluoro-3-hydroxy-2-methyldecanamide (PubChem CID 11011232) has the molecular formula C15H30FNO2 and a molecular weight of 275.41 g/mol. Its IUPAC name is (2S,3S)-N,N-diethyl-2-fluoro-3-hydroxy-2-methyldecanamide.
| Compound Name | (2S,3S)-N,N-diethyl-2-fluoro-3-hydroxy-2-methyldecanamide |
|---|---|
| PubChem CID | 11011232 |
| Molecular Formula | C15H30FNO2 |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.23 |
| IUPAC Name | (2S,3S)-N,N-diethyl-2-fluoro-3-hydroxy-2-methyldecanamide |
| SMILES | CCCCCCC[C@H](O)[C@](C)(F)C(=O)N(CC)CC |
| InChI | InChI=1S/C15H30FNO2/c1-5-8-9-10-11-12-13(18)15(4,16)14(19)17(6-2)7-3/h13,18H,5-12H2,1-4H3/t13-,15-/m0/s1 |
| InChIKey | NZOLXZUQMSDPFN-ZFWWWQNUSA-N |
| XLogP | 3.30 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|