About CID 11011373
CID 11011373 (PubChem CID 11011373) has the molecular formula C14H28GaN-
and a molecular weight of 280.11 g/mol.
Molecular Properties
| Compound Name | CID 11011373 |
| PubChem CID | 11011373 |
| Molecular Formula | C14H28GaN- |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | — |
| SMILES | C1CCC([N-]C2CCCCC2)CC1.C[Ga]C |
| InChI | InChI=1S/C12H22N.2CH3.Ga/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;;/h11-12H,1-10H2;2*1H3;/q-1;;; |
| InChIKey | KSYPZOOPLQLMNX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 11011373 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11011373?
The IUPAC name of CID 11011373 (CID 11011373) is not available.
What is the SMILES notation for CID 11011373?
The canonical SMILES for CID 11011373 is C1CCC([N-]C2CCCCC2)CC1.C[Ga]C.
What is the InChIKey of CID 11011373?
The InChIKey is KSYPZOOPLQLMNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N.2CH3.Ga/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;;/h11-12H,1-10H2;2*1H3;/q-1;;;.
What are the key properties of CID 11011373?
CID 11011373 has a molecular weight of 280.11 g/mol, XLogP of 4.81, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11011373 is sourced from PubChem (CID 11011373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).